EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31N3O5 |
| Net Charge | 0 |
| Average Mass | 405.495 |
| Monoisotopic Mass | 405.22637 |
| SMILES | NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17-,18-/m0/s1 |
| InChIKey | RLAWWYSOJDYHDC-BZSNNMDCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lisinopril (CHEBI:43755) has part L-lysine residue (CHEBI:29967) |
| lisinopril (CHEBI:43755) has part L-prolino group (CHEBI:32866) |
| lisinopril (CHEBI:43755) has role antiatherosclerotic agent (CHEBI:145947) |
| lisinopril (CHEBI:43755) has role antihypertensive agent (CHEBI:35674) |
| lisinopril (CHEBI:43755) has role antineoplastic agent (CHEBI:35610) |
| lisinopril (CHEBI:43755) has role cardiovascular drug (CHEBI:35554) |
| lisinopril (CHEBI:43755) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| lisinopril (CHEBI:43755) has role gastrointestinal drug (CHEBI:55324) |
| lisinopril (CHEBI:43755) has role hypoglycemic agent (CHEBI:35526) |
| lisinopril (CHEBI:43755) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| MK 351A (CHEBI:177385) has functional parent lisinopril (CHEBI:43755) |
| lisinopril dihydrate (CHEBI:6503) has part lisinopril (CHEBI:43755) |
| IUPAC Name |
|---|
| N2-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-proline |
| Synonyms | Source |
|---|---|
| (S)-1-(N2-(1-carboxy-3-phenylpropyl)-L-lysyl)-L-proline | ChemIDplus |
| lisinopril anhydrous | ChemIDplus |
| lisinopril anhydrous | ChEMBL |
| [N2-[(S)-1-CARBOXY-3-PHENYLPROPYL]-L-LYSYL-L-PROLINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 1587 | DrugCentral |
| DB00722 | DrugBank |
| Lisinopril | Wikipedia |
| LPR | PDBeChem |
| LSM-5756 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4276619 | Beilstein |
| CAS:76547-98-3 | ChemIDplus |
| Citations |
|---|