EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36N4O6 |
| Net Charge | 0 |
| Average Mass | 524.618 |
| Monoisotopic Mass | 524.26348 |
| SMILES | O=C(O)[C@H](CCc1ccccc1)N[C@@H](CCCCN/C=N/c1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C28H36N4O6/c33-22-14-12-21(13-15-22)30-19-29-17-5-4-9-23(26(34)32-18-6-10-25(32)28(37)38)31-24(27(35)36)16-11-20-7-2-1-3-8-20/h1-3,7-8,12-15,19,23-25,31,33H,4-6,9-11,16-18H2,(H,29,30)(H,35,36)(H,37,38)/t23-,24-,25-/m0/s1 |
| InChIKey | IQNWLCXGCZTZFI-SDHOMARFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Application: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MK 351A (CHEBI:177385) has functional parent lisinopril (CHEBI:43755) |
| MK 351A (CHEBI:177385) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| MK 351A (CHEBI:177385) is a benzenes (CHEBI:22712) |
| MK 351A (CHEBI:177385) is a dicarboxylic acid (CHEBI:35692) |
| MK 351A (CHEBI:177385) is a formamidines (CHEBI:51917) |
| MK 351A (CHEBI:177385) is a phenols (CHEBI:33853) |
| MK 351A (CHEBI:177385) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N2-[(1S)-1-carboxy-3-phenylpropyl]-N6-{(E)-[(4-hydroxyphenyl)imino]methyl}-L-lysyl-L-proline |
| Synonyms | Source |
|---|---|
| 351A | ChemIDplus |
| compound 351 A | ChemIDplus |
| N2-[(S)-1-carboxy-3-phenylpropyl]-N6-[(4-hydroxyphenyl)iminomethyl]-L-Lys-L-Pro-OH | ChEBI |
| MK 351A | ChemIDplus |
| MK-351A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 108943 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:92234-10-1 | ChemIDplus |
| Citations |
|---|