EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31N3O5.2H2O |
| Net Charge | 0 |
| Average Mass | 441.525 |
| Monoisotopic Mass | 441.24750 |
| SMILES | NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O.[H]O[H].[H]O[H] |
| InChI | InChI=1S/C21H31N3O5.2H2O/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15;;/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29);2*1H2/t16-,17-,18-;;/m0../s1 |
| InChIKey | CZRQXSDBMCMPNJ-ZUIPZQNBSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lisinopril dihydrate (CHEBI:6503) has part lisinopril (CHEBI:43755) |
| lisinopril dihydrate (CHEBI:6503) has role antihypertensive agent (CHEBI:35674) |
| lisinopril dihydrate (CHEBI:6503) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| N2-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-proline dihydrate |
| Synonyms | Source |
|---|---|
| Lisinopril dihydrate | ChemIDplus |
| Renacor | ChemIDplus |
| Lisinopril | ChemIDplus |
| (S)-1-(N2-(1-carboxy-3-phenylpropyl)-L-lysyl)-L-proline dihydrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D00362 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9460785 | Beilstein |
| CAS:83915-83-7 | ChemIDplus |