EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H48N6O8 |
| Net Charge | 0 |
| Average Mass | 560.693 |
| Monoisotopic Mass | 560.35336 |
| SMILES | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN |
| InChI | InChI=1S/C25H48N6O8/c1-21(32)29(37)18-9-3-6-16-27-22(33)12-14-25(36)31(39)20-10-4-7-17-28-23(34)11-13-24(35)30(38)19-8-2-5-15-26/h37-39H,2-20,26H2,1H3,(H,27,33)(H,28,34) |
| InChIKey | UBQYURCVBFRUQT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces pilosus (ncbitaxon:28893) | - | PubMed (30701380) | |
| Streptomyces sviceus (ncbitaxon:285530) | - | PubMed (33784308) |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferrioxamine B (CHEBI:4356) has role bacterial metabolite (CHEBI:76969) |
| desferrioxamine B (CHEBI:4356) has role ferroptosis inhibitor (CHEBI:173084) |
| desferrioxamine B (CHEBI:4356) has role iron chelator (CHEBI:38157) |
| desferrioxamine B (CHEBI:4356) has role siderophore (CHEBI:26672) |
| desferrioxamine B (CHEBI:4356) is a acyclic desferrioxamine (CHEBI:50454) |
| desferrioxamine B (CHEBI:4356) is conjugate acid of desferrioxamine B(3−) (CHEBI:84700) |
| desferrioxamine B (CHEBI:4356) is conjugate base of desferrioxamine B(1+) (CHEBI:195191) |
| Incoming Relation(s) |
| desferrioxamine B mesylate (CHEBI:31460) has part desferrioxamine B (CHEBI:4356) |
| desferrioxamine B(1+) (CHEBI:195191) is conjugate acid of desferrioxamine B (CHEBI:4356) |
| desferrioxamine B(3−) (CHEBI:84700) is conjugate base of desferrioxamine B (CHEBI:4356) |
| IUPAC Name |
|---|
| N'-{5-[acetyl(hydroxy)amino]pentyl}-N-(5-{4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanamido}pentyl)-N-hydroxybutanediamide |
| INNs | Source |
|---|---|
| deferoxamina | WHO MedNet |
| deferoxamine | WHO MedNet |
| déferoxamine | WHO MedNet |
| deferoxaminum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Deferoxamin | DrugBank |
| Deferrioxamine | DrugBank |
| deferrioxamine B | ChemIDplus |
| Desferrioxamine | DrugBank |
| desferrioxamine-B | ChEBI |
| DFO | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2867 | ChemSpider |
| 792 | DrugCentral |
| BE609053 | Patent |
| C06940 | KEGG COMPOUND |
| D03670 | KEGG DRUG |
| DB00746 | DrugBank |
| Deferoxamine | Wikipedia |
| HMDB0014884 | HMDB |
| LMFA08020169 | LIPID MAPS |
| LSM-6541 | LINCS |
| Citations |
|---|