EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H45N6O8 |
| Net Charge | -3 |
| Average Mass | 557.669 |
| Monoisotopic Mass | 557.33153 |
| SMILES | CC(=O)N([O-])CCCCCNC(=O)CCC(=O)N([O-])CCCCCNC(=O)CCC(=O)N([O-])CCCCCN |
| InChI | InChI=1S/C25H45N6O8/c1-21(32)29(37)18-9-3-6-16-27-22(33)12-14-25(36)31(39)20-10-4-7-17-28-23(34)11-13-24(35)30(38)19-8-2-5-15-26/h2-20,26H2,1H3,(H,27,33)(H,28,34)/q-3 |
| InChIKey | ZTZKLNOYBOAHJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferrioxamine B(3−) (CHEBI:84700) has role siderophore (CHEBI:26672) |
| desferrioxamine B(3−) (CHEBI:84700) is a hydroxamic acid anion (CHEBI:24648) |
| desferrioxamine B(3−) (CHEBI:84700) is conjugate base of desferrioxamine B (CHEBI:4356) |
| Incoming Relation(s) |
| ferrioxamine B (CHEBI:5044) has part desferrioxamine B(3−) (CHEBI:84700) |
| desferrioxamine B (CHEBI:4356) is conjugate acid of desferrioxamine B(3−) (CHEBI:84700) |
| IUPAC Name |
|---|
| [acetyl(27-amino-11,22-dioxido-7,10,18,21-tetraoxo-6,11,17,22-tetraazaheptacos-1-yl)amino]oxidanide |