EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C25H48N6O8.CH3O3S |
| Net Charge | 0 |
| Average Mass | 656.800 |
| Monoisotopic Mass | 656.34148 |
| SMILES | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN.CS(=O)(=O)[O-].[H+] |
| InChI | InChI=1S/C25H48N6O8.CH4O3S/c1-21(32)29(37)18-9-3-6-16-27-22(33)12-14-25(36)31(39)20-10-4-7-17-28-23(34)11-13-24(35)30(38)19-8-2-5-15-26;1-5(2,3)4/h37-39H,2-20,26H2,1H3,(H,27,33)(H,28,34);1H3,(H,2,3,4) |
| InChIKey | IDDIJAWJANBQLJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Role: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Application: | antidote Any protective agent counteracting or neutralizing the action of poisons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferrioxamine B mesylate (CHEBI:31460) has part desferrioxamine B (CHEBI:4356) |
| desferrioxamine B mesylate (CHEBI:31460) has role antidote (CHEBI:50247) |
| desferrioxamine B mesylate (CHEBI:31460) has role ferroptosis inhibitor (CHEBI:173084) |
| desferrioxamine B mesylate (CHEBI:31460) has role iron chelator (CHEBI:38157) |
| desferrioxamine B mesylate (CHEBI:31460) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| N'-{5-[acetyl(hydroxy)amino]pentyl}-N-(5-{4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanamido}pentyl)-N-hydroxybutanediamide methanesulfonate |
| Synonyms | Source |
|---|---|
| Deferoxamine B mesylate | ChemIDplus |
| Deferoxamine mesylate | ChemIDplus |
| Deferoxamine methanesulfonate | ChemIDplus |
| desferrioxamine B methanesulfonate | ChemIDplus |
| desferrioxamine mesilate | DrugBank |
| Desferrioxamine mesylate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Desferal | DrugBank |
| Desferin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| CPD-8951 | MetaCyc |
| D01186 | KEGG DRUG |
| DBSALT000964 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6047788 | Beilstein |
| CAS:138-14-7 | ChemIDplus |
| Citations |
|---|