EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4317 - dantrolene
| Formula | C14H10N4O5 |
| Net Charge | 0 |
| Average Mass | 314.257 |
| Monoisotopic Mass | 314.06512 |
| SMILES | [H]C(=NN1CC(=O)NC1=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C14H10N4O5/c19-13-8-17(14(20)16-13)15-7-11-5-6-12(23-11)9-1-3-10(4-2-9)18(21)22/h1-7H,8H2,(H,16,19,20) |
| InChIKey | OZOMQRBLCMDCEG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | ryanodine receptor antagonist A ryanodine receptor modulator which deactivates the receptor. |
| Applications: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dantrolene (CHEBI:4317) has role muscle relaxant (CHEBI:51371) |
| dantrolene (CHEBI:4317) has role neuroprotective agent (CHEBI:63726) |
| dantrolene (CHEBI:4317) has role ryanodine receptor antagonist (CHEBI:146223) |
| dantrolene (CHEBI:4317) is a hydrazone (CHEBI:38532) |
| dantrolene (CHEBI:4317) is a imidazolidine-2,4-dione (CHEBI:24628) |
| dantrolene (CHEBI:4317) is conjugate acid of dantrolene(1−) (CHEBI:59697) |
| Incoming Relation(s) |
| dantrolene(1−) (CHEBI:59697) is conjugate base of dantrolene (CHEBI:4317) |
| IUPAC Name |
|---|
| 1-({[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione |
| INNs | Source |
|---|---|
| dantroleno | ChemIDplus |
| dantrolenum | ChemIDplus |
| dantrolene | ChemIDplus |
| Synonyms | Source |
|---|---|
| Dantrolene | KEGG COMPOUND |
| 1-((5-(p-nitrophenyl)furfurylidene)amino)hydantoin | ChemIDplus |
| Citations |
|---|