EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9N4O5 |
| Net Charge | -1 |
| Average Mass | 313.249 |
| Monoisotopic Mass | 313.05784 |
| SMILES | [H]C(=NN1CC(=O)[N-]C1=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C14H10N4O5/c19-13-8-17(14(20)16-13)15-7-11-5-6-12(23-11)9-1-3-10(4-2-9)18(21)22/h1-7H,8H2,(H,16,19,20)/p-1 |
| InChIKey | OZOMQRBLCMDCEG-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dantrolene(1−) (CHEBI:59697) is a organic anion (CHEBI:25696) |
| dantrolene(1−) (CHEBI:59697) is conjugate base of dantrolene (CHEBI:4317) |
| Incoming Relation(s) |
| dantrolene sodium (anhydrous) (CHEBI:4318) has part dantrolene(1−) (CHEBI:59697) |
| dantrolene (CHEBI:4317) is conjugate acid of dantrolene(1−) (CHEBI:59697) |
| IUPAC Name |
|---|
| 3-({[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)-2,5-dioxoimidazolidin-1-ide |
| Synonyms | Source |
|---|---|
| dantrolene anion | ChEBI |
| 1-((5-(p-nitrophenyl)furfurylidene)amino)hydantoin anion | ChEBI |