EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N |
| Net Charge | 0 |
| Average Mass | 135.210 |
| Monoisotopic Mass | 135.10480 |
| SMILES | C[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m1/s1 |
| InChIKey | KWTSXDURSIMDCE-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-amphetamine (CHEBI:42724) is a 1-phenylpropan-2-amine (CHEBI:132233) |
| (R)-amphetamine (CHEBI:42724) is enantiomer of (S)-amphetamine (CHEBI:4469) |
| Incoming Relation(s) |
| amphetamine (CHEBI:2679) has part (R)-amphetamine (CHEBI:42724) |
| (S)-amphetamine (CHEBI:4469) is enantiomer of (R)-amphetamine (CHEBI:42724) |
| IUPAC Name |
|---|
| (2R)-1-phenylpropan-2-amine |
| Synonyms | Source |
|---|---|
| (R)-α-methylbenzeneethanamine | ChemIDplus |
| levamfetamine | ChemIDplus |
| levamphetamine | ChemIDplus |
| (R)-amphetamine | ChemIDplus |
| (R)-α-methylphenethylamine | ChemIDplus |
| (−)-amphetamine | ChemIDplus |