EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
| InChIKey | XHEFDIBZLJXQHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fisetin (CHEBI:42567) has role anti-inflammatory agent (CHEBI:67079) |
| fisetin (CHEBI:42567) has role antioxidant (CHEBI:22586) |
| fisetin (CHEBI:42567) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| fisetin (CHEBI:42567) has role geroprotector (CHEBI:176497) |
| fisetin (CHEBI:42567) has role metabolite (CHEBI:25212) |
| fisetin (CHEBI:42567) has role plant metabolite (CHEBI:76924) |
| fisetin (CHEBI:42567) is a 3'-hydroxyflavonoid (CHEBI:27741) |
| fisetin (CHEBI:42567) is a 7-hydroxyflavonol (CHEBI:52267) |
| fisetin (CHEBI:42567) is a tetrahydroxyflavone (CHEBI:38684) |
| fisetin (CHEBI:42567) is conjugate acid of fisetin(1−) (CHEBI:71992) |
| Incoming Relation(s) |
| fisetin 8-C-glucoside (CHEBI:5065) has functional parent fisetin (CHEBI:42567) |
| fustin (CHEBI:5202) has functional parent fisetin (CHEBI:42567) |
| fisetin(1−) (CHEBI:71992) is conjugate base of fisetin (CHEBI:42567) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Fisetin | KEGG COMPOUND |
| 7,3',4'-Trihydroxyflavonol | KEGG COMPOUND |
| 3,3',4',7-Tetrahydroxyflavone | ChemIDplus |
| 5-Desoxyquercetin | ChemIDplus |
| 2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| 3,7,3',4'-TETRAHYDROXYFLAVONE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C10041 | KEGG COMPOUND |
| FSE | PDBeChem |
| DB07795 | DrugBank |
| CPD-13503 | MetaCyc |
| Fisetin | Wikipedia |
| LMPK12111566 | LIPID MAPS |
| CN102028680 | Patent |
| US2010010078 | Patent |
| C00004579 | KNApSAcK |
| LSM-6579 | LINCS |
| 4444933 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:292829 | Beilstein |
| Reaxys:292829 | Reaxys |
| CAS:528-48-3 | KEGG COMPOUND |
| CAS:528-48-3 | ChemIDplus |
| Citations |
|---|