EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
| InChIKey | XHEFDIBZLJXQHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fisetin (CHEBI:42567) has role anti-inflammatory agent (CHEBI:67079) |
| fisetin (CHEBI:42567) has role antioxidant (CHEBI:22586) |
| fisetin (CHEBI:42567) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| fisetin (CHEBI:42567) has role geroprotector (CHEBI:176497) |
| fisetin (CHEBI:42567) has role metabolite (CHEBI:25212) |
| fisetin (CHEBI:42567) has role plant metabolite (CHEBI:76924) |
| fisetin (CHEBI:42567) is a 3'-hydroxyflavonoid (CHEBI:27741) |
| fisetin (CHEBI:42567) is a 7-hydroxyflavonol (CHEBI:52267) |
| fisetin (CHEBI:42567) is a tetrahydroxyflavone (CHEBI:38684) |
| fisetin (CHEBI:42567) is conjugate acid of fisetin(1−) (CHEBI:71992) |
| Incoming Relation(s) |
| fisetin 8-C-glucoside (CHEBI:5065) has functional parent fisetin (CHEBI:42567) |
| fustin (CHEBI:5202) has functional parent fisetin (CHEBI:42567) |
| fisetin(1−) (CHEBI:71992) is conjugate base of fisetin (CHEBI:42567) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| 3,3',4',7-Tetrahydroxyflavone | ChemIDplus |
| 3,7,3',4'-TETRAHYDROXYFLAVONE | PDBeChem |
| 5-Desoxyquercetin | ChemIDplus |
| 7,3',4'-Trihydroxyflavonol | KEGG COMPOUND |
| Fisetin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 4444933 | ChemSpider |
| C00004579 | KNApSAcK |
| C10041 | KEGG COMPOUND |
| CN102028680 | Patent |
| CPD-13503 | MetaCyc |
| DB07795 | DrugBank |
| Fisetin | Wikipedia |
| FSE | PDBeChem |
| LMPK12111566 | LIPID MAPS |
| LSM-6579 | LINCS |
| US2010010078 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:292829 | Reaxys |
| Beilstein:292829 | Beilstein |
| CAS:528-48-3 | KEGG COMPOUND |
| CAS:528-48-3 | ChemIDplus |
| Citations |
|---|