EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | O=C1c2ccc(O)cc2OC(c2ccc(O)c(O)c2)C1O |
| InChI | InChI=1S/C15H12O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,14-18,20H |
| InChIKey | FNUPUYFWZXZMIE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fustin (CHEBI:5202) has functional parent fisetin (CHEBI:42567) |
| fustin (CHEBI:5202) has role antiviral agent (CHEBI:22587) |
| fustin (CHEBI:5202) has role plant metabolite (CHEBI:76924) |
| fustin (CHEBI:5202) is a 4'-hydroxyflavanones (CHEBI:140331) |
| fustin (CHEBI:5202) is a dihydroflavonols (CHEBI:48039) |
| fustin (CHEBI:5202) is a secondary α-hydroxy ketone (CHEBI:2468) |
| fustin (CHEBI:5202) is a tetrahydroxyflavanone (CHEBI:38742) |
| Incoming Relation(s) |
| fustin 3-O-β-D-galactoside (CHEBI:28183) has functional parent fustin (CHEBI:5202) |
| (+)-trans-fustin (CHEBI:228234) is a fustin (CHEBI:5202) |
| (−)-trans-fustin (CHEBI:228235) is a fustin (CHEBI:5202) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2,3-dihydrofisetin | KEGG COMPOUND |
| 3,3',4',7-tetrahydroxyflavanone | ChemIDplus |
| 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydro-4H-1-benzopyran-4-one | IUPAC |
| 3,7,3',4'-tetrahydroxyflavanone | ChEBI |
| 3',4',7-trihydroxyflavanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Fustin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:101849-13-2 | ChEBI |
| Citations |
|---|