EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)ccc12 |
| InChI | InChI=1S/C21H20O11/c22-6-12-15(27)16(28)18(30)21(31-12)13-10(24)4-2-8-14(26)17(29)19(32-20(8)13)7-1-3-9(23)11(25)5-7/h1-5,12,15-16,18,21-25,27-30H,6H2/t12-,15-,16+,18-,21+/m1/s1 |
| InChIKey | GVDZEEZFEKPWPL-GOXGMXGVSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fisetin 8-C-glucoside (CHEBI:5065) has functional parent fisetin (CHEBI:42567) |
| fisetin 8-C-glucoside (CHEBI:5065) has role plant metabolite (CHEBI:76924) |
| fisetin 8-C-glucoside (CHEBI:5065) is a 3'-hydroxyflavonoid (CHEBI:27741) |
| fisetin 8-C-glucoside (CHEBI:5065) is a 7-hydroxyflavonol (CHEBI:52267) |
| fisetin 8-C-glucoside (CHEBI:5065) is a flavone C-glycoside (CHEBI:83280) |
| fisetin 8-C-glucoside (CHEBI:5065) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4-oxo-4H-1-benzopyran-8-yl]-D-glucitol |
| Synonym | Source |
|---|---|
| Fisetin 8-C-glucoside | KEGG COMPOUND |
| Citations |
|---|