EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O2 |
| Net Charge | 0 |
| Average Mass | 288.431 |
| Monoisotopic Mass | 288.20893 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | MUMGGOZAMZWBJJ-KZYORJDKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epitestosterone (CHEBI:42534) has role androgen antagonist (CHEBI:35497) |
| epitestosterone (CHEBI:42534) has role human metabolite (CHEBI:77746) |
| epitestosterone (CHEBI:42534) is a 17α-hydroxy steroid (CHEBI:35342) |
| epitestosterone (CHEBI:42534) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| epitestosterone (CHEBI:42534) is a androstanoid (CHEBI:50402) |
| Incoming Relation(s) |
| epitestosterone 17-O-(β-D-glucuronide) (CHEBI:137491) has functional parent epitestosterone (CHEBI:42534) |
| epitestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136673) has functional parent epitestosterone (CHEBI:42534) |
| IUPAC Name |
|---|
| 17α-hydroxyandrost-4-en-3-one |
| Synonym | Source |
|---|---|
| epi-testosterone | ChEBI |
| UniProt Name | Source |
|---|---|
| epitestosterone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| FFA | PDBeChem |
| LMST02020051 | LIPID MAPS |
| Epitestosterone | Wikipedia |
| HMDB0000628 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2220727 | Reaxys |
| CAS:481-30-1 | ChemIDplus |
| Citations |
|---|