EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O8 |
| Net Charge | 0 |
| Average Mass | 464.555 |
| Monoisotopic Mass | 464.24102 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H36O8/c1-24-9-7-13(26)11-12(24)3-4-14-15-5-6-17(25(15,2)10-8-16(14)24)32-23-20(29)18(27)19(28)21(33-23)22(30)31/h11,14-21,23,27-29H,3-10H2,1-2H3,(H,30,31)/t14-,15-,16-,17+,18-,19-,20+,21-,23+,24-,25-/m0/s1 |
| InChIKey | NIKZPECGCSUSBV-RWUBDERLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epitestosterone 17-O-(β-D-glucuronide) (CHEBI:137491) has functional parent epitestosterone (CHEBI:42534) |
| epitestosterone 17-O-(β-D-glucuronide) (CHEBI:137491) is a 3-oxo steroid (CHEBI:47788) |
| epitestosterone 17-O-(β-D-glucuronide) (CHEBI:137491) is a enone (CHEBI:51689) |
| epitestosterone 17-O-(β-D-glucuronide) (CHEBI:137491) is a steroid glucosiduronic acid (CHEBI:26763) |
| epitestosterone 17-O-(β-D-glucuronide) (CHEBI:137491) is a β-D-glucosiduronic acid (CHEBI:15341) |
| epitestosterone 17-O-(β-D-glucuronide) (CHEBI:137491) is conjugate acid of epitestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136673) |
| Incoming Relation(s) |
| epitestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136673) is conjugate base of epitestosterone 17-O-(β-D-glucuronide) (CHEBI:137491) |
| IUPAC Name |
|---|
| 3-oxoandrost-4-en-17α-yl β-D-glucopyranosiduronic acid |
| Synonym | Source |
|---|---|
| 17α-testosterone 17-O-(β-D-glucuronide) | ChEBI |
| Citations |
|---|