EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:16998 - D-phenylalanine
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1 |
| InChIKey | COLNVLDHVKWLRT-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-phenylalanine (CHEBI:16998) is a D-α-amino acid (CHEBI:16733) |
| D-phenylalanine (CHEBI:16998) is a phenylalanine (CHEBI:28044) |
| D-phenylalanine (CHEBI:16998) is conjugate acid of D-phenylalaninate (CHEBI:32494) |
| D-phenylalanine (CHEBI:16998) is conjugate base of D-phenylalaninium (CHEBI:32495) |
| D-phenylalanine (CHEBI:16998) is enantiomer of L-phenylalanine (CHEBI:17295) |
| D-phenylalanine (CHEBI:16998) is tautomer of D-phenylalanine zwitterion (CHEBI:57981) |
| Incoming Relation(s) |
| N-acyl-D-phenylalanine (CHEBI:77672) has functional parent D-phenylalanine (CHEBI:16998) |
| D-phenylalanine derivative (CHEBI:84143) has functional parent D-phenylalanine (CHEBI:16998) |
| D-phenylalaninium (CHEBI:32495) is conjugate acid of D-phenylalanine (CHEBI:16998) |
| D-phenylalaninate (CHEBI:32494) is conjugate base of D-phenylalanine (CHEBI:16998) |
| L-phenylalanine (CHEBI:17295) is enantiomer of D-phenylalanine (CHEBI:16998) |
| D-phenylalanine residue (CHEBI:29996) is substituent group from D-phenylalanine (CHEBI:16998) |
| D-phenylalanino group (CHEBI:32502) is substituent group from D-phenylalanine (CHEBI:16998) |
| D-phenylalanyl group (CHEBI:32500) is substituent group from D-phenylalanine (CHEBI:16998) |
| D-phenylalanine zwitterion (CHEBI:57981) is tautomer of D-phenylalanine (CHEBI:16998) |
| IUPAC Names |
|---|
| (2R)-2-amino-3-phenylpropanoic acid |
| D-phenylalanine |
| Synonyms | Source |
|---|---|
| D-alpha-Amino-beta-phenylpropionic acid | KEGG COMPOUND |
| D-Phenylalanine | KEGG COMPOUND |
| D-PHENYLALANINE | PDBeChem |
| DPN | PDBeChem |
| phenylalanine D-form | ChemIDplus |
| D-Phe | ChEBI |
| Citations |
|---|