EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO2 |
| Net Charge | -1 |
| Average Mass | 164.184 |
| Monoisotopic Mass | 164.07170 |
| SMILES | N[C@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/p-1/t8-/m1/s1 |
| InChIKey | COLNVLDHVKWLRT-MRVPVSSYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-phenylalaninate (CHEBI:32494) is a phenylalaninate (CHEBI:32504) |
| D-phenylalaninate (CHEBI:32494) is conjugate base of D-phenylalanine (CHEBI:16998) |
| D-phenylalaninate (CHEBI:32494) is enantiomer of L-phenylalaninate (CHEBI:32486) |
| Incoming Relation(s) |
| D-phenylalanine (CHEBI:16998) is conjugate acid of D-phenylalaninate (CHEBI:32494) |
| L-phenylalaninate (CHEBI:32486) is enantiomer of D-phenylalaninate (CHEBI:32494) |
| IUPAC Name |
|---|
| D-phenylalaninate |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-phenylpropanoate | IUPAC |
| D-phenylalanine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5740552 | Beilstein |
| Gmelin:746993 | Gmelin |