EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | [NH3+][C@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1 |
| InChIKey | COLNVLDHVKWLRT-MRVPVSSYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-phenylalanine zwitterion (CHEBI:57981) is a D-α-amino acid zwitterion (CHEBI:59871) |
| D-phenylalanine zwitterion (CHEBI:57981) is enantiomer of L-phenylalanine zwitterion (CHEBI:58095) |
| D-phenylalanine zwitterion (CHEBI:57981) is tautomer of D-phenylalanine (CHEBI:16998) |
| Incoming Relation(s) |
| L-phenylalanine zwitterion (CHEBI:58095) is enantiomer of D-phenylalanine zwitterion (CHEBI:57981) |
| D-phenylalanine (CHEBI:16998) is tautomer of D-phenylalanine zwitterion (CHEBI:57981) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-phenylpropanoate |
| Synonym | Source |
|---|---|
| (2R)-2-ammonio-3-phenylpropanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| D-phenylalanine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-216 | MetaCyc |