EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22O12 |
| Net Charge | 0 |
| Average Mass | 502.428 |
| Monoisotopic Mass | 502.11113 |
| SMILES | O=C(O)CC(=O)OC[C@H]1O[C@@H](Oc2ccc3c(=O)c(-c4ccc(O)cc4)coc3c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H22O12/c25-12-3-1-11(2-4-12)15-9-33-16-7-13(5-6-14(16)20(15)29)35-24-23(32)22(31)21(30)17(36-24)10-34-19(28)8-18(26)27/h1-7,9,17,21-25,30-32H,8,10H2,(H,26,27)/t17-,21-,22+,23-,24-/m1/s1 |
| InChIKey | MTXMHWSVSZKYBT-ASDZUOGYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | - | PubMed (25053043) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonyldaidzin (CHEBI:80371) has functional parent daidzein 7-O-β-D-glucoside (CHEBI:42202) |
| malonyldaidzin (CHEBI:80371) has role plant metabolite (CHEBI:76924) |
| malonyldaidzin (CHEBI:80371) is a glycosyloxyisoflavone (CHEBI:74630) |
| malonyldaidzin (CHEBI:80371) is a hydroxyisoflavone (CHEBI:38755) |
| malonyldaidzin (CHEBI:80371) is a malonate ester (CHEBI:38083) |
| malonyldaidzin (CHEBI:80371) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 6-O-(carboxyacetyl)-β-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| C16191 | KEGG COMPOUND |
| HMDB0041263 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4895660 | Reaxys |
| Citations |
|---|