EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:421840 - O-methylsalicylic acid
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | COc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H8O3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | ILUJQPXNXACGAN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-methylsalicylic acid (CHEBI:421840) has role flavouring agent (CHEBI:35617) |
| O-methylsalicylic acid (CHEBI:421840) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| O-methylsalicylic acid (CHEBI:421840) is a methoxybenzoic acid (CHEBI:25238) |
| O-methylsalicylic acid (CHEBI:421840) is conjugate acid of O-methylsalicylate (CHEBI:59128) |
| Incoming Relation(s) |
| cyprosulfamide (CHEBI:132270) has functional parent O-methylsalicylic acid (CHEBI:421840) |
| O-methylsalicylate (CHEBI:59128) is conjugate base of O-methylsalicylic acid (CHEBI:421840) |
| IUPAC Name |
|---|
| 2-methoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 2-Anisic acid | ChemIDplus |
| 2-Methoxy-benzoic acid | ChEMBL |
| o-anisic acid | ChEBI |
| ortho-methoxybenzoic acid | ChEBI |
| o-Methoxybenzoic acid | ChemIDplus |
| Salicylic acid methyl ether | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2-Methoxybenzoic_acid | Wikipedia |
| HMDB0032604 | HMDB |
| O-Methoxybenzoic_acid | Wikipedia |
| Citations |
|---|