EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O3 |
| Net Charge | -1 |
| Average Mass | 151.141 |
| Monoisotopic Mass | 151.04007 |
| SMILES | COc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H8O3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10)/p-1 |
| InChIKey | ILUJQPXNXACGAN-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-methylsalicylate (CHEBI:59128) is a methoxybenzoate (CHEBI:25236) |
| O-methylsalicylate (CHEBI:59128) is conjugate base of O-methylsalicylic acid (CHEBI:421840) |
| Incoming Relation(s) |
| 2-methoxybenzoyl-AMP(1−) (CHEBI:188493) has functional parent O-methylsalicylate (CHEBI:59128) |
| 2-methoxybenzoyl-CoA(4−) (CHEBI:188490) has functional parent O-methylsalicylate (CHEBI:59128) |
| 3,6-dichloro-2-methoxybenzoate (CHEBI:141349) has functional parent O-methylsalicylate (CHEBI:59128) |
| O-methylsalicylic acid (CHEBI:421840) is conjugate acid of O-methylsalicylate (CHEBI:59128) |
| Synonym | Source |
|---|---|
| o-methoxybenzoic acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methoxybenzoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:329974 | Gmelin |
| Reaxys:3905613 | Reaxys |