EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O5S |
| Net Charge | 0 |
| Average Mass | 374.418 |
| Monoisotopic Mass | 374.09364 |
| SMILES | COc1ccccc1C(=O)NS(=O)(=O)c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-25-16-5-3-2-4-15(16)18(22)20-26(23,24)14-10-6-12(7-11-14)17(21)19-13-8-9-13/h2-7,10-11,13H,8-9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | OAWUUPVZMNKZRY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | herbicide safener A compound used with herbicides that reduces the effect of the herbicide on crop plants or otherwise improves the selectivity of the herbicide for weed species over the crop plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyprosulfamide (CHEBI:132270) has functional parent O-methylsalicylic acid (CHEBI:421840) |
| cyprosulfamide (CHEBI:132270) has role herbicide safener (CHEBI:132272) |
| cyprosulfamide (CHEBI:132270) is a N-sulfonylcarboxamide (CHEBI:90852) |
| cyprosulfamide (CHEBI:132270) is a cyclopropanes (CHEBI:51454) |
| IUPAC Name |
|---|
| N-{[4-(cyclopropylcarbamoyl)phenyl]sulfonyl}-2-methoxybenzamide |
| Synonyms | Source |
|---|---|
| N-{[4-(cyclopropylcarbamoyl)phenyl]sulfonyl}-2-methoxybenzamide | Alan Wood's Pesticides |
| N-[[4-[(cyclopropylamino)carbonyl]phenyl]sulfonyl]-2-methoxybenzamide | Alan Wood's Pesticides |
| N-[4-(cyclopropylcarbamoyl)benzene-1-sulfonyl]-2-methoxybenzamide | Alan Wood's Pesticides |
| N-[4-(cyclopropylcarbamoyl)phenylsulfonyl]-o-anisamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| cyprosulfamide | Alan Wood's Pesticides |
| 1283 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322594 | Reaxys |
| CAS:221667-31-8 | ChemIDplus |
| CAS:221667-31-8 | Alan Wood's Pesticides |
| Citations |
|---|