EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:42017 - 2,4-dinitrophenol
| Formula | C6H4N2O5 |
| Net Charge | 0 |
| Average Mass | 184.107 |
| Monoisotopic Mass | 184.01202 |
| SMILES | O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N2O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H |
| InChIKey | UFBJCMHMOXMLKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardioides sp. (ncbitaxon:35761) | - | PubMed (25281383) | Strain: JS1661 |
| Roles Classification |
|---|
| Biological Roles: | oxidative phosphorylation inhibitor Any compound that inhibits oxidative phosphorylation. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dinitrophenol (CHEBI:42017) has role allergen (CHEBI:50904) |
| 2,4-dinitrophenol (CHEBI:42017) has role antiseptic drug (CHEBI:48218) |
| 2,4-dinitrophenol (CHEBI:42017) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2,4-dinitrophenol (CHEBI:42017) has role geroprotector (CHEBI:176497) |
| 2,4-dinitrophenol (CHEBI:42017) has role oxidative phosphorylation inhibitor (CHEBI:73267) |
| 2,4-dinitrophenol (CHEBI:42017) is a dinitrophenol (CHEBI:39352) |
| 2,4-dinitrophenol (CHEBI:42017) is conjugate acid of 2,4-dinitrophenol(1−) (CHEBI:84561) |
| Incoming Relation(s) |
| 4,6-dinitro-o-cresol (CHEBI:39349) has functional parent 2,4-dinitrophenol (CHEBI:42017) |
| 2,4-dinitrophenol(1−) (CHEBI:84561) is conjugate base of 2,4-dinitrophenol (CHEBI:42017) |
| IUPAC Name |
|---|
| 2,4-dinitrophenol |
| Synonyms | Source |
|---|---|
| 1-hydroxy-2,4-dinitrobenzene | ChemIDplus |
| 2,4-Dinitrophenol | KEGG COMPOUND |
| 2,4-DINITROPHENOL | PDBeChem |
| 2,4-DNP | NIST Chemistry WebBook |
| α-dinitrophenol | NIST Chemistry WebBook |
| Citations |
|---|