EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:42017 - 2,4-dinitrophenol
| Formula | C6H4N2O5 |
| Net Charge | 0 |
| Average Mass | 184.107 |
| Monoisotopic Mass | 184.01202 |
| SMILES | O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N2O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H |
| InChIKey | UFBJCMHMOXMLKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardioides sp. (ncbitaxon:35761) | - | PubMed (25281383) | Strain: JS1661 |
| Roles Classification |
|---|
| Biological Roles: | oxidative phosphorylation inhibitor Any compound that inhibits oxidative phosphorylation. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dinitrophenol (CHEBI:42017) has role allergen (CHEBI:50904) |
| 2,4-dinitrophenol (CHEBI:42017) has role antiseptic drug (CHEBI:48218) |
| 2,4-dinitrophenol (CHEBI:42017) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2,4-dinitrophenol (CHEBI:42017) has role geroprotector (CHEBI:176497) |
| 2,4-dinitrophenol (CHEBI:42017) has role oxidative phosphorylation inhibitor (CHEBI:73267) |
| 2,4-dinitrophenol (CHEBI:42017) is a dinitrophenol (CHEBI:39352) |
| 2,4-dinitrophenol (CHEBI:42017) is conjugate acid of 2,4-dinitrophenol(1−) (CHEBI:84561) |
| Incoming Relation(s) |
| 4,6-dinitro-o-cresol (CHEBI:39349) has functional parent 2,4-dinitrophenol (CHEBI:42017) |
| 2,4-dinitrophenol(1−) (CHEBI:84561) is conjugate base of 2,4-dinitrophenol (CHEBI:42017) |
| IUPAC Name |
|---|
| 2,4-dinitrophenol |
| Synonyms | Source |
|---|---|
| 1-hydroxy-2,4-dinitrobenzene | ChemIDplus |
| 2,4-Dinitrophenol | KEGG COMPOUND |
| 2,4-DINITROPHENOL | PDBeChem |
| 2,4-DNP | NIST Chemistry WebBook |
| α-dinitrophenol | NIST Chemistry WebBook |
| Citations |
|---|