EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39349 - 4,6-dinitro-o-cresol
| Formula | C7H6N2O5 |
| Net Charge | 0 |
| Average Mass | 198.134 |
| Monoisotopic Mass | 198.02767 |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3 |
| InChIKey | ZXVONLUNISGICL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungicide A substance used to destroy fungal pests. |
| Applications: | fungicide A substance used to destroy fungal pests. herbicide A substance used to destroy plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6-dinitro-o-cresol (CHEBI:39349) has functional parent o-cresol (CHEBI:28054) |
| 4,6-dinitro-o-cresol (CHEBI:39349) has functional parent 2,4-dinitrophenol (CHEBI:42017) |
| 4,6-dinitro-o-cresol (CHEBI:39349) has role dinitrophenol insecticide (CHEBI:39415) |
| 4,6-dinitro-o-cresol (CHEBI:39349) has role fungicide (CHEBI:24127) |
| 4,6-dinitro-o-cresol (CHEBI:39349) has role herbicide (CHEBI:24527) |
| 4,6-dinitro-o-cresol (CHEBI:39349) is a dinitrophenol acaricide (CHEBI:39363) |
| 4,6-dinitro-o-cresol (CHEBI:39349) is a hydroxytoluene (CHEBI:24751) |
| 4,6-dinitro-o-cresol (CHEBI:39349) is a nitrotoluene (CHEBI:25566) |
| IUPAC Name |
|---|
| 2-methyl-4,6-dinitrophenol |
| Synonyms | Source |
|---|---|
| DNOC | ChemIDplus |
| 3,5-dinitro-2-hydroxytoluene | ChemIDplus |
| Antinonnin | NIST Chemistry WebBook |
| 4,6-dinitro-o-cresol | NIST Chemistry WebBook |
| 6-methyl-2,4-dinitrophenol | NIST Chemistry WebBook |
| 2,4-Dinitro-6-methylphenol | KEGG COMPOUND |
| Citations |
|---|