EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3N2O5 |
| Net Charge | -1 |
| Average Mass | 183.099 |
| Monoisotopic Mass | 183.00474 |
| SMILES | O=[N+]([O-])c1ccc([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N2O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H/p-1 |
| InChIKey | UFBJCMHMOXMLKC-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardioides sp. (ncbitaxon:35761) | - | PubMed (25281383) | Strain: JS1661 |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dinitrophenol(1−) (CHEBI:84561) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2,4-dinitrophenol(1−) (CHEBI:84561) is a phenolate anion (CHEBI:50525) |
| 2,4-dinitrophenol(1−) (CHEBI:84561) is conjugate base of 2,4-dinitrophenol (CHEBI:42017) |
| Incoming Relation(s) |
| 2,4-dinitrophenol (CHEBI:42017) is conjugate acid of 2,4-dinitrophenol(1−) (CHEBI:84561) |
| IUPAC Name |
|---|
| 2,4-dinitrophenolate |
| Synonym | Source |
|---|---|
| 2,4-Dinitrophenol ion(1-) | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2,4-dinitrophenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8179 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3552508 | Reaxys |
| CAS:20350-26-9 | ChemIDplus |
| Citations |
|---|