EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:420128 - 5-chlorosalicylic acid
| Formula | C7H5ClO3 |
| Net Charge | 0 |
| Average Mass | 172.567 |
| Monoisotopic Mass | 171.99272 |
| SMILES | O=C(O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C7H5ClO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | NKBASRXWGAGQDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chlorosalicylic acid (CHEBI:420128) has functional parent benzoic acid (CHEBI:30746) |
| 5-chlorosalicylic acid (CHEBI:420128) is a chlorobenzoic acid (CHEBI:23134) |
| 5-chlorosalicylic acid (CHEBI:420128) is a monochlorobenzenes (CHEBI:83403) |
| 5-chlorosalicylic acid (CHEBI:420128) is a monohydroxybenzoic acid (CHEBI:25389) |
| 5-chlorosalicylic acid (CHEBI:420128) is conjugate acid of 5-chlorosalicylate (CHEBI:59131) |
| Incoming Relation(s) |
| niclosamide (CHEBI:7553) has functional parent 5-chlorosalicylic acid (CHEBI:420128) |
| 5-chlorosalicylate (CHEBI:59131) is conjugate base of 5-chlorosalicylic acid (CHEBI:420128) |
| IUPAC Name |
|---|
| 5-chloro-2-hydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-5-chlorobenzoic acid | ChemIDplus |
| 5-Chloro-2-hydroxybenzoic acid | ChemIDplus |
| 5 CSA | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| CN101684061 | Patent |
| Citations |
|---|