EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8Cl2N2O4 |
| Net Charge | 0 |
| Average Mass | 327.123 |
| Monoisotopic Mass | 325.98611 |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) |
| InChIKey | RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | STAT3 inhibitor An inhibitor of signal transducer and activator of transcription 3 (STAT3) apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. molluscicide A substance used to destroy pests of the phylum Mollusca. anthelminthic drug Substance intended to kill parasitic worms (helminths). piscicide A substance which is poisonous to fish and is primarily used to eliminate dominant species of fish in water. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| niclosamide (CHEBI:7553) has functional parent 5-chlorosalicylic acid (CHEBI:420128) |
| niclosamide (CHEBI:7553) has role anthelminthic drug (CHEBI:35443) |
| niclosamide (CHEBI:7553) has role anticoronaviral agent (CHEBI:149553) |
| niclosamide (CHEBI:7553) has role antiparasitic agent (CHEBI:35442) |
| niclosamide (CHEBI:7553) has role apoptosis inducer (CHEBI:68495) |
| niclosamide (CHEBI:7553) has role molluscicide (CHEBI:33904) |
| niclosamide (CHEBI:7553) has role piscicide (CHEBI:167183) |
| niclosamide (CHEBI:7553) has role STAT3 inhibitor (CHEBI:87183) |
| niclosamide (CHEBI:7553) is a C-nitro compound (CHEBI:35716) |
| niclosamide (CHEBI:7553) is a benzamides (CHEBI:22702) |
| niclosamide (CHEBI:7553) is a monochlorobenzenes (CHEBI:83403) |
| niclosamide (CHEBI:7553) is a salicylanilides (CHEBI:53468) |
| niclosamide (CHEBI:7553) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| INNs | Source |
|---|---|
| niclosamida | WHO MedNet |
| niclosamide | WHO MedNet |
| niclosamide | WHO MedNet |
| niclosamidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2',5-dichloro-2-hydroxy-4'-nitrobenzanilide | Alan Wood's Pesticides |
| 2',5-dichloro-4'-nitrosalicylanilide | Alan Wood's Pesticides |
| 2-chloro-4-nitrophenylamide-6-chlorosalicylic acid | ChemIDplus |
| 2-hydroxy-5-chloro-N-(2-chloro-4-nitrophenyl)benzamide | ChemIDplus |
| 5-chloro-2'-chloro-4'-nitrosalicylanilide | ChemIDplus |
| 5-chloro-N-(2'-chloro-4'-nitrophenyl)salicylamide | ChemIDplus |
| Brand Names | Source |
|---|---|
| Atenase | ChemIDplus |
| Bayluscide | ChemIDplus |
| Cestocid | ChemIDplus |
| Devermin | ChemIDplus |
| Devermine | ChemIDplus |
| Fedal-Telmin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1912 | DrugCentral |
| 1929 | PPDB |
| 1929 | VSDB |
| 4322 | ChemSpider |
| D00436 | KEGG DRUG |
| DB06803 | DrugBank |
| HMDB0015679 | HMDB |
| LSM-2787 | LINCS |
| niclosamide | Alan Wood's Pesticides |
| Niclosamide | Wikipedia |
| Citations |
|---|