EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4ClO3 |
| Net Charge | -1 |
| Average Mass | 171.559 |
| Monoisotopic Mass | 170.98545 |
| SMILES | O=C([O-])c1cc(Cl)ccc1O |
| InChI | InChI=1S/C7H5ClO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,(H,10,11)/p-1 |
| InChIKey | NKBASRXWGAGQDP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chlorosalicylate (CHEBI:59131) is a chlorobenzoate (CHEBI:23133) |
| 5-chlorosalicylate (CHEBI:59131) is a hydroxybenzoate (CHEBI:24675) |
| 5-chlorosalicylate (CHEBI:59131) is conjugate base of 5-chlorosalicylic acid (CHEBI:420128) |
| Incoming Relation(s) |
| 5-chlorosalicylic acid (CHEBI:420128) is conjugate acid of 5-chlorosalicylate (CHEBI:59131) |
| UniProt Name | Source |
|---|---|
| 5-chlorosalicylate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:482088 | Gmelin |
| Reaxys:3608526 | Reaxys |
| Citations |
|---|