EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9N3O2 |
| Net Charge | 0 |
| Average Mass | 155.157 |
| Monoisotopic Mass | 155.06948 |
| SMILES | N[C@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m1/s1 |
| InChIKey | HNDVDQJCIGZPNO-RXMQYKEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (15744050) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-histidine (CHEBI:27947) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| D-histidine (CHEBI:27947) is a D-α-amino acid (CHEBI:16733) |
| D-histidine (CHEBI:27947) is a histidine (CHEBI:27570) |
| D-histidine (CHEBI:27947) is conjugate acid of D-histidinate(1−) (CHEBI:32523) |
| D-histidine (CHEBI:27947) is conjugate base of D-histidinium(1+) (CHEBI:32526) |
| D-histidine (CHEBI:27947) is enantiomer of L-histidine (CHEBI:15971) |
| D-histidine (CHEBI:27947) is tautomer of D-histidine zwitterion (CHEBI:142967) |
| Incoming Relation(s) |
| D-histidine derivative (CHEBI:84077) has functional parent D-histidine (CHEBI:27947) |
| D-histidinium(1+) (CHEBI:32526) is conjugate acid of D-histidine (CHEBI:27947) |
| D-histidinate(1−) (CHEBI:32523) is conjugate base of D-histidine (CHEBI:27947) |
| L-histidine (CHEBI:15971) is enantiomer of D-histidine (CHEBI:27947) |
| N2-D-histidino group (CHEBI:32518) is substituent group from D-histidine (CHEBI:27947) |
| Nπ-D-histidino group (CHEBI:32520) is substituent group from D-histidine (CHEBI:27947) |
| Nτ-D-histidino group (CHEBI:32521) is substituent group from D-histidine (CHEBI:27947) |
| D-histidine residue (CHEBI:29980) is substituent group from D-histidine (CHEBI:27947) |
| D-histidyl group (CHEBI:32522) is substituent group from D-histidine (CHEBI:27947) |
| D-histidine zwitterion (CHEBI:142967) is tautomer of D-histidine (CHEBI:27947) |
| IUPAC Names |
|---|
| (2R)-2-amino-3-(1H-imidazol-4-yl)propanoic acid |
| D-histidine |
| Synonyms | Source |
|---|---|
| DHI | PDBeChem |
| D-Histidine | KEGG COMPOUND |
| D-HISTIDINE | PDBeChem |
| (R)-alpha-Amino-1H-imidazole-4-propionic acid | KEGG COMPOUND |
| D-Histidin | ChEBI |
| Citations |
|---|