EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N3O2 |
| Net Charge | -1 |
| Average Mass | 154.149 |
| Monoisotopic Mass | 154.06220 |
| SMILES | N[C@H](Cc1cncn1)C(=O)[O-] |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/p-1/t5-/m1/s1 |
| InChIKey | HNDVDQJCIGZPNO-RXMQYKEDSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (15744050) |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-histidinate(1−) (CHEBI:32523) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| D-histidinate(1−) (CHEBI:32523) is a histidinate(1−) (CHEBI:32529) |
| D-histidinate(1−) (CHEBI:32523) is conjugate acid of D-histidinate(2−) (CHEBI:32524) |
| D-histidinate(1−) (CHEBI:32523) is conjugate base of D-histidine (CHEBI:27947) |
| D-histidinate(1−) (CHEBI:32523) is enantiomer of L-histidinate(1−) (CHEBI:32510) |
| Incoming Relation(s) |
| D-histidine (CHEBI:27947) is conjugate acid of D-histidinate(1−) (CHEBI:32523) |
| D-histidinate(2−) (CHEBI:32524) is conjugate base of D-histidinate(1−) (CHEBI:32523) |
| L-histidinate(1−) (CHEBI:32510) is enantiomer of D-histidinate(1−) (CHEBI:32523) |
| IUPAC Name |
|---|
| hydrogen D-histidinate |
| Synonyms | Source |
|---|---|
| D-histidinate(1−) | JCBN |
| D-histidine monoanion | JCBN |
| (2R)-2-amino-3-(1H-imidazol-4-yl)propanoate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7251557 | Beilstein |
| Gmelin:774476 | Gmelin |