EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48095 - keto-D-fructose
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m1/s1 |
| InChIKey | BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-D-fructose (CHEBI:48095) is a keto-fructose (CHEBI:37723) |
| keto-D-fructose (CHEBI:48095) is a D-fructose (CHEBI:15824) |
| keto-D-fructose (CHEBI:48095) is enantiomer of keto-L-fructose (CHEBI:37724) |
| Incoming Relation(s) |
| keto-D-fructuronic acid (CHEBI:47950) has functional parent keto-D-fructose (CHEBI:48095) |
| fructosamine 3-phosphate (CHEBI:87178) has functional parent keto-D-fructose (CHEBI:48095) |
| fructoselysine 6-phosphate (CHEBI:61437) has functional parent keto-D-fructose (CHEBI:48095) |
| keto-L-fructose (CHEBI:37724) is enantiomer of keto-D-fructose (CHEBI:48095) |
| IUPAC Name |
|---|
| keto-D-fructose |
| Synonyms | Source |
|---|---|
| D-Fructose | KEGG COMPOUND |
| D-(−)-fructose | ChemIDplus |
| D-(−)-levulose | ChemIDplus |
| UniProt Name | Source |
|---|---|
| keto-D-fructose | UniProt |