EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(CO)[C@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO211h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m0/s1 |
| InChIKey | BJHIKXHVCXFQLS-FUTKDDECSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-L-fructose (CHEBI:37724) is a keto-fructose (CHEBI:37723) |
| keto-L-fructose (CHEBI:37724) is a L-fructose (CHEBI:28120) |
| keto-L-fructose (CHEBI:37724) is enantiomer of keto-D-fructose (CHEBI:48095) |
| Incoming Relation(s) |
| keto-D-fructose (CHEBI:48095) is enantiomer of keto-L-fructose (CHEBI:37724) |
| IUPAC Name |
|---|
| keto-L-fructose |
| UniProt Name | Source |
|---|---|
| keto-L-fructose | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1724560 | Beilstein |