EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO |
| WURCS | WURCS=2.0/1,1,0/[A112Oh]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-5,7,9-11H,1H2,(H,12,13)/t3-,4+,5+/m1/s1 |
| InChIKey | IZSRJDGCGRAUAR-WISUUJSJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-D-fructuronic acid (CHEBI:47950) has functional parent keto-D-fructose (CHEBI:48095) |
| keto-D-fructuronic acid (CHEBI:47950) is a D-fructuronic acid (CHEBI:20937) |
| keto-D-fructuronic acid (CHEBI:47950) is conjugate acid of keto-D-fructuronate (CHEBI:59881) |
| Incoming Relation(s) |
| keto-D-fructuronate (CHEBI:59881) is conjugate base of keto-D-fructuronic acid (CHEBI:47950) |
| IUPAC Name |
|---|
| keto-D-fructuronic acid |
| Synonym | Source |
|---|---|
| (2S,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1726802 | Beilstein |