EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H25N2O10P |
| Net Charge | 0 |
| Average Mass | 388.310 |
| Monoisotopic Mass | 388.12468 |
| SMILES | N[C@@H](CCCCNCC(=O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C12H25N2O10P/c13-7(12(19)20)3-1-2-4-14-5-8(15)10(17)11(18)9(16)6-24-25(21,22)23/h7,9-11,14,16-18H,1-6,13H2,(H,19,20)(H2,21,22,23)/t7-,9+,10+,11+/m0/s1 |
| InChIKey | ZICZRZZPXBCXCE-AYHFEMFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fructoselysine 6-phosphate (CHEBI:61437) has functional parent keto-D-fructose (CHEBI:48095) |
| fructoselysine 6-phosphate (CHEBI:61437) has role Escherichia coli metabolite (CHEBI:76971) |
| fructoselysine 6-phosphate (CHEBI:61437) is a L-lysine derivative (CHEBI:25095) |
| fructoselysine 6-phosphate (CHEBI:61437) is a amino sugar phosphate (CHEBI:22529) |
| fructoselysine 6-phosphate (CHEBI:61437) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| fructoselysine 6-phosphate (CHEBI:61437) is conjugate acid of fructoselysine 6-phosphate(1−) (CHEBI:61392) |
| Incoming Relation(s) |
| fructoselysine 6-phosphate(1−) (CHEBI:61392) is conjugate base of fructoselysine 6-phosphate (CHEBI:61437) |
| IUPAC Name |
|---|
| N6-[(3S,4R,5R)-3,4,5-trihydroxy-2-oxo-6-(phosphonooxy)hexyl]-L-lysine |
| Synonyms | Source |
|---|---|
| fructose L-lysine-6-phosphate | ChEBI |
| fructosyllysine 6-phosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16489 | KEGG COMPOUND |