EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO3 |
| Net Charge | 0 |
| Average Mass | 275.348 |
| Monoisotopic Mass | 275.15214 |
| SMILES | [H][C@@]1(c2ccc(OC)c(OC3CCCC3)c2)CNC(=O)C1 |
| InChI | InChI=1S/C16H21NO3/c1-19-14-7-6-11(12-9-16(18)17-10-12)8-15(14)20-13-4-2-3-5-13/h6-8,12-13H,2-5,9-10H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | HJORMJIFDVBMOB-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-rolipram (CHEBI:40133) is a rolipram (CHEBI:104872) |
| (−)-rolipram (CHEBI:40133) is enantiomer of (+)-rolipram (CHEBI:59540) |
| Incoming Relation(s) |
| (+)-rolipram (CHEBI:59540) is enantiomer of (−)-rolipram (CHEBI:40133) |
| IUPAC Name |
|---|
| (4R)-4-[3-(cyclopentyloxy)-4-methoxyphenyl]pyrrolidin-2-one |
| Synonyms | Source |
|---|---|
| (R)-(−)-rolipram | ChEBI |
| (R)-rolipram | ChEBI |
| (R)-4-(3-Cyclopentyloxy-4-methoxy-phenyl)-pyrrolidin-2-one | ChEMBL |
| ROLIPRAM | PDBeChem |