EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO3 |
| Net Charge | 0 |
| Average Mass | 275.348 |
| Monoisotopic Mass | 275.15214 |
| SMILES | COc1ccc(C2CNC(=O)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C16H21NO3/c1-19-14-7-6-11(12-9-16(18)17-10-12)8-15(14)20-13-4-2-3-5-13/h6-8,12-13H,2-5,9-10H2,1H3,(H,17,18) |
| InChIKey | HJORMJIFDVBMOB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rolipram (CHEBI:104872) has role antidepressant (CHEBI:35469) |
| rolipram (CHEBI:104872) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| rolipram (CHEBI:104872) is a pyrrolidin-2-ones (CHEBI:74223) |
| Incoming Relation(s) |
| (+)-rolipram (CHEBI:59540) is a rolipram (CHEBI:104872) |
| (−)-rolipram (CHEBI:40133) is a rolipram (CHEBI:104872) |
| IUPAC Name |
|---|
| 4-[3-(cyclopentyloxy)-4-methoxyphenyl]pyrrolidin-2-one |
| INNs | Source |
|---|---|
| rolipram | ChemIDplus |
| rolipramum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(3-(Cyclopentyloxy)-4-methoxyphenyl)-2-pyrrolidinone | ChemIDplus |
| ZK 62711 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1588548 | Beilstein |
| Reaxys:1588548 | Reaxys |
| CAS:61413-54-5 | ChemIDplus |
| Citations |
|---|