EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO |
| Net Charge | 0 |
| Average Mass | 143.230 |
| Monoisotopic Mass | 143.13101 |
| SMILES | CCCC(CCC)C(N)=O |
| InChI | InChI=1S/C8H17NO/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | OMOMUFTZPTXCHP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valpromide (CHEBI:74562) has functional parent valproic acid (CHEBI:39867) |
| valpromide (CHEBI:74562) has role geroprotector (CHEBI:176497) |
| valpromide (CHEBI:74562) has role metabolite (CHEBI:25212) |
| valpromide (CHEBI:74562) has role teratogenic agent (CHEBI:50905) |
| valpromide (CHEBI:74562) is a fatty amide (CHEBI:29348) |
| IUPAC Name |
|---|
| 2-propylpentanamide |
| Synonyms | Source |
|---|---|
| 2-ethylvaleramide | MetaCyc |
| Depamide | KEGG DRUG |
| VPD | ChEBI |
| VPM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-10097 | MetaCyc |
| D02766 | KEGG DRUG |
| DB04165 | DrugBank |
| HMDB0259756 | HMDB |
| Valpromide | Wikipedia |
| VPR | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1750444 | Reaxys |
| CAS:2430-27-5 | ChemIDplus |
| Citations |
|---|