EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO |
| Net Charge | 0 |
| Average Mass | 143.230 |
| Monoisotopic Mass | 143.13101 |
| SMILES | CCCC(CCC)C(N)=O |
| InChI | InChI=1S/C8H17NO/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | OMOMUFTZPTXCHP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valpromide (CHEBI:74562) has functional parent valproic acid (CHEBI:39867) |
| valpromide (CHEBI:74562) has role geroprotector (CHEBI:176497) |
| valpromide (CHEBI:74562) has role metabolite (CHEBI:25212) |
| valpromide (CHEBI:74562) has role teratogenic agent (CHEBI:50905) |
| valpromide (CHEBI:74562) is a fatty amide (CHEBI:29348) |
| IUPAC Name |
|---|
| 2-propylpentanamide |
| Synonyms | Source |
|---|---|
| 2-ethylvaleramide | MetaCyc |
| Depamide | KEGG DRUG |
| VPD | ChEBI |
| VPM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-10097 | MetaCyc |
| D02766 | KEGG DRUG |
| DB04165 | DrugBank |
| HMDB0259756 | HMDB |
| Valpromide | Wikipedia |
| VPR | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1750444 | Reaxys |
| CAS:2430-27-5 | ChemIDplus |
| Citations |
|---|