EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O4 |
| Net Charge | 0 |
| Average Mass | 226.232 |
| Monoisotopic Mass | 226.09536 |
| SMILES | C[C@@](Cc1ccc(O)c(O)c1)(NN)C(=O)O |
| InChI | InChI=1S/C10H14N2O4/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6/h2-4,12-14H,5,11H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | TZFNLOMSOLWIDK-JTQLQIEISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of aromatic-L-amino-acid decarboxylase (EC 4.1.1.28). dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| Applications: | dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbidopa (anhydrous) (CHEBI:39585) has role antiparkinson drug (CHEBI:48407) |
| carbidopa (anhydrous) (CHEBI:39585) has role dopaminergic agent (CHEBI:48560) |
| carbidopa (anhydrous) (CHEBI:39585) has role EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor (CHEBI:59321) |
| carbidopa (anhydrous) (CHEBI:39585) is a catechols (CHEBI:33566) |
| carbidopa (anhydrous) (CHEBI:39585) is a hydrazines (CHEBI:24631) |
| carbidopa (anhydrous) (CHEBI:39585) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| foscarbidopa (CHEBI:192511) has functional parent carbidopa (anhydrous) (CHEBI:39585) |
| carbidopa (CHEBI:3395) has part carbidopa (anhydrous) (CHEBI:39585) |
| IUPAC Name |
|---|
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
| INN | Source |
|---|---|
| carbidopum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (S)-(−)-carbidopa | ChEBI |
| (S)-carbidopa | ChEBI |
| L-3-(3,4-dihydroxyphenyl)-2-methyl-2-hydrazinopropionic acid | ChemIDplus |
| (−)-L-α-hydrazino-3,4-dihydroxy-α-methylhydrocinnamic acid | ChemIDplus |
| L-α-methyldopahydrazine | ChemIDplus |
| (αS)-α-hydrazino-3,4-dihydroxy-α-methylbenzenepropanoic acid | ChEBI |