EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O4.H2O |
| Net Charge | 0 |
| Average Mass | 244.247 |
| Monoisotopic Mass | 244.10592 |
| SMILES | C[C@@](Cc1ccc(O)c(O)c1)(NN)C(=O)O.O |
| InChI | InChI=1S/C10H14N2O4.H2O/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6;/h2-4,12-14H,5,11H2,1H3,(H,15,16);1H2/t10-;/m0./s1 |
| InChIKey | QTAOMKOIBXZKND-PPHPATTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of aromatic-L-amino-acid decarboxylase (EC 4.1.1.28). dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbidopa (CHEBI:3395) has part carbidopa (anhydrous) (CHEBI:39585) |
| carbidopa (CHEBI:3395) has role antidyskinesia agent (CHEBI:66956) |
| carbidopa (CHEBI:3395) has role antiparkinson drug (CHEBI:48407) |
| carbidopa (CHEBI:3395) has role dopaminergic agent (CHEBI:48560) |
| carbidopa (CHEBI:3395) has role EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor (CHEBI:59321) |
| carbidopa (CHEBI:3395) is a catechols (CHEBI:33566) |
| carbidopa (CHEBI:3395) is a hydrate (CHEBI:35505) |
| carbidopa (CHEBI:3395) is a hydrazines (CHEBI:24631) |
| carbidopa (CHEBI:3395) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid—water (1/1) |
| INN | Source |
|---|---|
| carbidopa | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid monohydrate | ChEBI |
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid hydrate | ChEBI |
| (−)-L-α-hydrazino-3,4-dihydroxy-α-methylhydrocinnamic acid monohydrate | ChemIDplus |
| carbidopa monohydrate | DrugBank |
| carbidopa hydrate | ChEBI |
| carbidopum monohydricum | ChEBI |
| Citations |
|---|