EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O4.H2O |
| Net Charge | 0 |
| Average Mass | 244.247 |
| Monoisotopic Mass | 244.10592 |
| SMILES | C[C@@](Cc1ccc(O)c(O)c1)(NN)C(=O)O.O |
| InChI | InChI=1S/C10H14N2O4.H2O/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6;/h2-4,12-14H,5,11H2,1H3,(H,15,16);1H2/t10-;/m0./s1 |
| InChIKey | QTAOMKOIBXZKND-PPHPATTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of aromatic-L-amino-acid decarboxylase (EC 4.1.1.28). dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbidopa (CHEBI:3395) has part carbidopa (anhydrous) (CHEBI:39585) |
| carbidopa (CHEBI:3395) has role antidyskinesia agent (CHEBI:66956) |
| carbidopa (CHEBI:3395) has role antiparkinson drug (CHEBI:48407) |
| carbidopa (CHEBI:3395) has role dopaminergic agent (CHEBI:48560) |
| carbidopa (CHEBI:3395) has role EC 4.1.1.28 (aromatic-L-amino-acid decarboxylase) inhibitor (CHEBI:59321) |
| carbidopa (CHEBI:3395) is a catechols (CHEBI:33566) |
| carbidopa (CHEBI:3395) is a hydrate (CHEBI:35505) |
| carbidopa (CHEBI:3395) is a hydrazines (CHEBI:24631) |
| carbidopa (CHEBI:3395) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid—water (1/1) |
| INN | Source |
|---|---|
| carbidopa | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid hydrate | ChEBI |
| (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid monohydrate | ChEBI |
| carbidopa hydrate | ChEBI |
| carbidopa monohydrate | DrugBank |
| carbidopum monohydricum | ChEBI |
| (S)-(−)-carbidopa hydrate | ChEBI |
| Citations |
|---|