EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192511 - foscarbidopa
| Formula | C10H15N2O7P |
| Net Charge | 0 |
| Average Mass | 306.211 |
| Monoisotopic Mass | 306.06169 |
| SMILES | C[C@@](Cc1ccc(OP(=O)(O)O)c(O)c1)(NN)C(=O)O |
| InChI | InChI=1S/C10H15N2O7P/c1-10(12-11,9(14)15)5-6-2-3-8(7(13)4-6)19-20(16,17)18/h2-4,12-13H,5,11H2,1H3,(H,14,15)(H2,16,17,18)/t10-/m0/s1 |
| InChIKey | PQUZXFMHVSMUNG-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| foscarbidopa (CHEBI:192511) has functional parent carbidopa (anhydrous) (CHEBI:39585) |
| foscarbidopa (CHEBI:192511) has role antiparkinson drug (CHEBI:48407) |
| foscarbidopa (CHEBI:192511) has role prodrug (CHEBI:50266) |
| foscarbidopa (CHEBI:192511) is a O-phosphoamino acid (CHEBI:21968) |
| foscarbidopa (CHEBI:192511) is a L-tyrosine derivative (CHEBI:27177) |
| foscarbidopa (CHEBI:192511) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| ABBV-951 (CHEBI:192512) has part foscarbidopa (CHEBI:192511) |
| IUPAC Name |
|---|
| (2S)-2-hydrazinyl-3-[3-hydroxy-4-(phosphonooxy)phenyl]-2-methylpropanoic acid |
| Synonym | Source |
|---|---|
| carbidopa 4'-monophosphate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1907685-81-7 | ChemIDplus |
| Citations |
|---|