EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H35FN2O5 |
| Net Charge | 0 |
| Average Mass | 558.650 |
| Monoisotopic Mass | 558.25300 |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C33H35FN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40)/t26-,27-/m1/s1 |
| InChIKey | XUKUURHRXDUEBC-KAYWLYCHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atorvastatin (CHEBI:39548) has functional parent heptanoic acid (CHEBI:45571) |
| atorvastatin (CHEBI:39548) has role environmental contaminant (CHEBI:78298) |
| atorvastatin (CHEBI:39548) has role xenobiotic (CHEBI:35703) |
| atorvastatin (CHEBI:39548) is a aromatic amide (CHEBI:62733) |
| atorvastatin (CHEBI:39548) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| atorvastatin (CHEBI:39548) is a monofluorobenzenes (CHEBI:83575) |
| atorvastatin (CHEBI:39548) is a pyrroles (CHEBI:26455) |
| atorvastatin (CHEBI:39548) is a statin (synthetic) (CHEBI:87635) |
| atorvastatin (CHEBI:39548) is conjugate acid of atorvastatin(1−) (CHEBI:50690) |
| Incoming Relation(s) |
| atorvastatin(1−) (CHEBI:50690) is conjugate base of atorvastatin (CHEBI:39548) |
| IUPAC Name |
|---|
| (3R,5R)-7-[3-(anilinocarbonyl)-5-(4-fluorophenyl)-4-phenyl-2-(propan-2-yl)-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
| INNs | Source |
|---|---|
| atorvastatin | ChemIDplus |
| atorvastatina | ChEBI |
| atorvastatine | ChEBI |
| atorvastatinum | ChEBI |
| Synonyms | Source |
|---|---|
| Atorvastatin | KEGG COMPOUND |
| (R-(R*,R*))-2-(4-Fluorophenyl)-beta,delta-dihydroxy-5-(1-methylethyl)-3-phenyl-4-((phenylamino)carbonyl)-1H-pyrrole-1-heptanoic acid | ChemIDplus |
| 7-[2-(4-FLUORO-PHENYL)-5-ISOPROPYL-3-PHENYL-4-PHENYLCARBAMOYL-PYRROL-1-YL]-3,5-DIHYDROXY-HEPTANOIC ACID | PDBeChem |
| Brand Names | Source |
|---|---|
| Atorlip | ChEBI |
| Atorpic | DrugBank |
| Liprimar | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C06834 | KEGG COMPOUND |
| 117 | PDBeChem |
| D07474 | KEGG DRUG |
| DB01076 | DrugBank |
| EP409281 | Patent |
| US5273995 | Patent |
| Atorvastatin | Wikipedia |
| HMDB0005006 | HMDB |
| LSM-5771 | LINCS |
| 257 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8373630 | Beilstein |
| Reaxys:8373630 | Reaxys |
| CAS:134523-00-5 | KEGG COMPOUND |
| CAS:134523-00-5 | ChemIDplus |
| Citations |
|---|