EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39411 - chloropropylate
| Formula | C17H16Cl2O3 |
| Net Charge | 0 |
| Average Mass | 339.218 |
| Monoisotopic Mass | 338.04765 |
| SMILES | CC(C)OC(=O)C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2O3/c1-11(2)22-16(20)17(21,12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h3-11,21H,1-2H3 |
| InChIKey | AXGUBXVWZBFQGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloropropylate (CHEBI:39411) has functional parent 4,4'-dichlorobenzilic acid (CHEBI:39413) |
| chloropropylate (CHEBI:39411) has role bridged diphenyl acaricide (CHEBI:39412) |
| chloropropylate (CHEBI:39411) is a isopropyl ester (CHEBI:35725) |
| chloropropylate (CHEBI:39411) is a monochlorobenzenes (CHEBI:83403) |
| chloropropylate (CHEBI:39411) is a organochlorine acaricide (CHEBI:38657) |
| chloropropylate (CHEBI:39411) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| propan-2-yl bis(4-chlorophenyl)(hydroxy)acetate |
| Synonyms | Source |
|---|---|
| Isopropyl 4,4'-dichlorobenzilate | ChemIDplus |
| 1-Methylethyl 4-chloro-α-(4-chlorophenyl)-α-hydroxybenzeneacetate | NIST Chemistry WebBook |