EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O |
| Net Charge | 0 |
| Average Mass | 108.140 |
| Monoisotopic Mass | 108.05751 |
| SMILES | Cc1ccccc1O |
| InChI | InChI=1S/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3 |
| InChIKey | QWVGKYWNOKOFNN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-cresol (CHEBI:28054) has role human xenobiotic metabolite (CHEBI:76967) |
| o-cresol (CHEBI:28054) is a cresol (CHEBI:25399) |
| Incoming Relation(s) |
| o-cresol hydrogen sulfate (CHEBI:133089) has functional parent o-cresol (CHEBI:28054) |
| 1-(2-methylphenyl)glycerol (CHEBI:94398) has functional parent o-cresol (CHEBI:28054) |
| 2-[(ethylsulfanyl)methyl]phenol (CHEBI:38487) has functional parent o-cresol (CHEBI:28054) |
| 2-methylanisole (CHEBI:141702) has functional parent o-cresol (CHEBI:28054) |
| 4-chloro-2-methylphenol (CHEBI:1800) has functional parent o-cresol (CHEBI:28054) |
| 4,6-dinitro-o-cresol (CHEBI:39349) has functional parent o-cresol (CHEBI:28054) |
| IUPAC Name |
|---|
| 2-methylphenol |
| Synonyms | Source |
|---|---|
| 1-hydroxy-2-methylbenzene | ChemIDplus |
| 2-cresol | ChemIDplus |
| 2-hydroxy-1-methylbenzene | ChemIDplus |
| 2-hydroxytoluene | ChemIDplus |
| 2-Hydroxytoluene | KEGG COMPOUND |
| o-cresylic acid | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-hydroxytoluene | UniProt |
| Citations |
|---|