EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N2OS |
| Net Charge | 0 |
| Average Mass | 384.589 |
| Monoisotopic Mass | 384.22353 |
| SMILES | CC(C)c1cc(Oc2ccccc2)cc(C(C)C)c1NC(=S)NC(C)(C)C |
| InChI | InChI=1S/C23H32N2OS/c1-15(2)19-13-18(26-17-11-9-8-10-12-17)14-20(16(3)4)21(19)24-22(27)25-23(5,6)7/h8-16H,1-7H3,(H2,24,25,27) |
| InChIKey | WOWBFOBYOAGEEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | oxidative phosphorylation inhibitor Any compound that inhibits oxidative phosphorylation. |
| Applications: | proinsecticide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proinsecticide. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diafenthiuron (CHEBI:39299) has functional parent diphenyl ether (CHEBI:39258) |
| diafenthiuron (CHEBI:39299) has role oxidative phosphorylation inhibitor (CHEBI:73267) |
| diafenthiuron (CHEBI:39299) has role proinsecticide (CHEBI:136644) |
| diafenthiuron (CHEBI:39299) is a aromatic ether (CHEBI:35618) |
| diafenthiuron (CHEBI:39299) is a thiourea acaricide (CHEBI:39296) |
| diafenthiuron (CHEBI:39299) is a thiourea insecticide (CHEBI:39295) |
| Incoming Relation(s) |
| diafenthiuron-S-oxide (CHEBI:141200) has functional parent diafenthiuron (CHEBI:39299) |
| IUPAC Name |
|---|
| 1-tert-butyl-3-(2,6-diisopropyl-4-phenoxyphenyl)thiourea |
| Synonyms | Source |
|---|---|
| 3-(2,6-diisopropyl-4-phenoxyphenyl)-1-tert-butylthiourea | ChemIDplus |
| CG 167 | ChEBI |
| CGA 106630 | ChemIDplus |
| CGA 106630 | ChEBI |
| Diafenthiuron | ChemIDplus |
| N-(2,6-bis(1-methylethyl)-4-phenoxyphenyl)-N'-(1,1-dimethylethyl)thiourea | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pegasus | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 210 | PPDB |
| C18781 | KEGG COMPOUND |
| diafenthiuron | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8343025 | Beilstein |
| CAS:80060-09-9 | ChemIDplus |
| CAS:80060-09-9 | KEGG COMPOUND |
| Citations |
|---|