EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N2O2S |
| Net Charge | 0 |
| Average Mass | 400.588 |
| Monoisotopic Mass | 400.21845 |
| SMILES | CC(C)c1cc(Oc2ccccc2)cc(C(C)C)c1NC(NC(C)(C)C)=S=O |
| InChI | InChI=1S/C23H32N2O2S/c1-15(2)19-13-18(27-17-11-9-8-10-12-17)14-20(16(3)4)21(19)24-22(28-26)25-23(5,6)7/h8-16,24-25H,1-7H3 |
| InChIKey | SYMTYAPISFTBCA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | oxidative phosphorylation inhibitor Any compound that inhibits oxidative phosphorylation. |
| Applications: | proacaricide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proacaricide. proinsecticide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proinsecticide. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diafenthiuron-S-oxide (CHEBI:141200) has functional parent diafenthiuron (CHEBI:39299) |
| diafenthiuron-S-oxide (CHEBI:141200) has role oxidative phosphorylation inhibitor (CHEBI:73267) |
| diafenthiuron-S-oxide (CHEBI:141200) has role proacaricide (CHEBI:136647) |
| diafenthiuron-S-oxide (CHEBI:141200) has role proinsecticide (CHEBI:136644) |
| diafenthiuron-S-oxide (CHEBI:141200) is a aromatic ether (CHEBI:35618) |
| diafenthiuron-S-oxide (CHEBI:141200) is a sulfoxide (CHEBI:22063) |
| diafenthiuron-S-oxide (CHEBI:141200) is a thiourea acaricide (CHEBI:39296) |
| diafenthiuron-S-oxide (CHEBI:141200) is a thiourea insecticide (CHEBI:39295) |
| IUPAC Name |
|---|
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)-1-(oxido-λ4-sulfanylidene)methanediamine |
| Synonyms | Source |
|---|---|
| 1-tert-butyl-3-(2,6-diisopropyl-4-phenoxyphenyl)thiourea-S-oxide | ChEBI |
| N-[2,6-bis(1-methylethyl)-4-phenoxyphenyl]-N'-(1,1-dimethylethyl)thiourea-S-oxide | ChEBI |
| N-tert-butyl-N'-[2,6-di(propan-2-yl)-4-phenoxyphenyl]carbonothioic diamide-S-oxide | ChEBI |