EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O |
| Net Charge | 0 |
| Average Mass | 170.211 |
| Monoisotopic Mass | 170.07316 |
| SMILES | c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| InChIKey | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenyl ether (CHEBI:39258) has role plant metabolite (CHEBI:76924) |
| diphenyl ether (CHEBI:39258) is a aromatic ether (CHEBI:35618) |
| Incoming Relation(s) |
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine (CHEBI:141491) has functional parent diphenyl ether (CHEBI:39258) |
| 2-fluoro-6-(4-methoxyphenoxy)benzonitrile (CHEBI:143239) has functional parent diphenyl ether (CHEBI:39258) |
| 4-bromophenyl phenyl ether (CHEBI:77421) has functional parent diphenyl ether (CHEBI:39258) |
| acrinathrin (CHEBI:39091) has functional parent diphenyl ether (CHEBI:39258) |
| cordyol C (CHEBI:64518) has functional parent diphenyl ether (CHEBI:39258) |
| diafenthiuron (CHEBI:39299) has functional parent diphenyl ether (CHEBI:39258) |
| flufenoxuron (CHEBI:39382) has functional parent diphenyl ether (CHEBI:39258) |
| phenoxybenzoic acid (CHEBI:72633) has functional parent diphenyl ether (CHEBI:39258) |
| phenoxyphenol (CHEBI:39262) has functional parent diphenyl ether (CHEBI:39258) |
| polybromodiphenyl ether (CHEBI:134094) has functional parent diphenyl ether (CHEBI:39258) |
| IUPAC Names |
|---|
| 1,1'-oxydibenzene |
| phenoxybenzene |
| Synonyms | Source |
|---|---|
| 1,1'-oxybis(benzene) | ChemIDplus |
| 1,1'-oxybisbenzene | NIST Chemistry WebBook |
| Diphenyläther | ChEBI |
| diphenyl ether | NIST Chemistry WebBook |
| Diphenylether | ChEBI |
| Diphenyloxid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Diphenyl_ether | Wikipedia |
| HMDB0034446 | HMDB |