EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N2O |
| Net Charge | 0 |
| Average Mass | 350.506 |
| Monoisotopic Mass | 350.23581 |
| SMILES | CC(C)c1cc(Oc2ccccc2)cc(C(C)C)c1N=C=NC(C)(C)C |
| InChI | InChI=1S/C23H30N2O/c1-16(2)20-13-19(26-18-11-9-8-10-12-18)14-21(17(3)4)22(20)24-15-25-23(5,6)7/h8-14,16-17H,1-7H3 |
| InChIKey | ADKCCGNTHYYZHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | oxidative phosphorylation inhibitor Any compound that inhibits oxidative phosphorylation. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine (CHEBI:141491) has functional parent diphenyl ether (CHEBI:39258) |
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine (CHEBI:141491) has role acaricide (CHEBI:22153) |
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine (CHEBI:141491) has role insecticide (CHEBI:24852) |
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine (CHEBI:141491) has role oxidative phosphorylation inhibitor (CHEBI:73267) |
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine (CHEBI:141491) is a aromatic ether (CHEBI:35618) |
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine (CHEBI:141491) is a benzenes (CHEBI:22712) |
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine (CHEBI:141491) is a carbodiimide (CHEBI:53091) |
| IUPAC Name |
|---|
| N-tert-butyl-N'-(2,6-diisopropyl-4-phenoxyphenyl)methanediimine |
| Synonyms | Source |
|---|---|
| 1-tert-butyl-3-(2,6-di-isopropyl-4-phenoxyphenyl)-carbodiimide | ChEBI |
| CGA-140408 | ChEBI |
| tert-butyl-(2,6-diisopropyl-4-phenoxyphenyl)carbodiimide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8395465 | Reaxys |
| Citations |
|---|