EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O2 |
| Net Charge | 0 |
| Average Mass | 242.403 |
| Monoisotopic Mass | 242.22458 |
| SMILES | CCC(C)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H30O2/c1-3-14(2)12-10-8-6-4-5-7-9-11-13-15(16)17/h14H,3-13H2,1-2H3,(H,16,17) |
| InChIKey | XKLJLHAPJBUBNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-methyltetradecanoic acid (CHEBI:39251) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 12-methyltetradecanoic acid (CHEBI:39251) is a long-chain fatty acid (CHEBI:15904) |
| Incoming Relation(s) |
| bacilysocin (CHEBI:71621) has functional parent 12-methyltetradecanoic acid (CHEBI:39251) |
| methyl 12-methyltetradecanoate (CHEBI:142658) has functional parent 12-methyltetradecanoic acid (CHEBI:39251) |
| staphyloxanthin (CHEBI:71690) has functional parent 12-methyltetradecanoic acid (CHEBI:39251) |
| IUPAC Name |
|---|
| 12-methyltetradecanoic acid |
| Synonyms | Source |
|---|---|
| 12-methyl myristic acid | LIPID MAPS |
| 12-methyl-tetradecanoic acid | ChEBI |
| 12-Methyl-tetradecansäure | ChEBI |
| 12-Methyltetradecansäure | ChEBI |
| 12-MTA | ChEBI |
| 15:0ai | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16665 | KEGG COMPOUND |
| LMFA01020008 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723971 | Reaxys |
| CAS:5502-94-3 | ChemIDplus |
| Citations |
|---|