EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H78O8 |
| Net Charge | 0 |
| Average Mass | 819.177 |
| Monoisotopic Mass | 818.56967 |
| SMILES | CCC(C)CCCCCCCCCCC(=O)OC[C@H]1O[C@@H](OC(=O)/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)CCC=C(C)C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C51H78O8/c1-10-39(4)26-17-15-13-11-12-14-16-18-36-46(52)57-37-45-47(53)48(54)49(55)51(58-45)59-50(56)44(9)35-24-34-43(8)33-23-31-41(6)28-20-19-27-40(5)30-22-32-42(7)29-21-25-38(2)3/h19-20,22-25,27-28,30-35,39,45,47-49,51,53-55H,10-18,21,26,29,36-37H2,1-9H3/b20-19+,30-22+,31-23+,34-24+,40-27+,41-28+,42-32+,43-33+,44-35+/t39?,45-,47-,48+,49-,51+/m1/s1 |
| InChIKey | PDOUICUKTQRPHO-MENSNCDRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. virulence factor Any toxin secreted by bacteria, viruses, fungi or protozoa enabling them to achieve colonisation of a niche in the host, inhibit or evade the host's immune response, enter and exit cells, or obtain nutrition from the host. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| staphyloxanthin (CHEBI:71690) has functional parent 12-methyltetradecanoic acid (CHEBI:39251) |
| staphyloxanthin (CHEBI:71690) has functional parent β-D-glucose (CHEBI:15903) |
| staphyloxanthin (CHEBI:71690) has role antioxidant (CHEBI:22586) |
| staphyloxanthin (CHEBI:71690) has role biological pigment (CHEBI:26130) |
| staphyloxanthin (CHEBI:71690) has role metabolite (CHEBI:25212) |
| staphyloxanthin (CHEBI:71690) has role virulence factor (CHEBI:72316) |
| staphyloxanthin (CHEBI:71690) is a D-aldohexose derivative (CHEBI:63387) |
| staphyloxanthin (CHEBI:71690) is a apo carotenoid triterpenoid (CHEBI:36783) |
| staphyloxanthin (CHEBI:71690) is a fatty acid ester (CHEBI:35748) |
| staphyloxanthin (CHEBI:71690) is a triol (CHEBI:27136) |
| staphyloxanthin (CHEBI:71690) is a xanthophyll (CHEBI:27325) |
| IUPAC Name |
|---|
| 1-O-[(2E,4E,6E,8E,10E,12E,14E,16E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenoyl]-6-O-(12-methyltetradecanoyl)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 8'-apo-ψ,ψ-carotenoic acid, 6-O-(12-methyl-1-oxotetradecyl)-α-D-glucopyranosyl ester | ChemIDplus |
| β-D-glucopyranosyl 1-O-(4,4'-diaponeurosporen-4-oate)-6-O-(12-methyltetradecanoate) | MetaCyc |
| UniProt Name | Source |
|---|---|
| staphyloxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16148 | KEGG COMPOUND |
| CPD-9916 | MetaCyc |
| Staphyloxanthin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22781667 | Reaxys |
| CAS:71869-01-7 | ChemIDplus |
| CAS:71869-01-7 | KEGG COMPOUND |
| Citations |
|---|