EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H78O8 |
| Net Charge | 0 |
| Average Mass | 819.177 |
| Monoisotopic Mass | 818.56967 |
| SMILES | CCC(C)CCCCCCCCCCC(=O)OC[C@H]1O[C@@H](OC(=O)/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)CCC=C(C)C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C51H78O8/c1-10-39(4)26-17-15-13-11-12-14-16-18-36-46(52)57-37-45-47(53)48(54)49(55)51(58-45)59-50(56)44(9)35-24-34-43(8)33-23-31-41(6)28-20-19-27-40(5)30-22-32-42(7)29-21-25-38(2)3/h19-20,22-25,27-28,30-35,39,45,47-49,51,53-55H,10-18,21,26,29,36-37H2,1-9H3/b20-19+,30-22+,31-23+,34-24+,40-27+,41-28+,42-32+,43-33+,44-35+/t39?,45-,47-,48+,49-,51+/m1/s1 |
| InChIKey | PDOUICUKTQRPHO-MENSNCDRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | virulence factor Any toxin secreted by bacteria, viruses, fungi or protozoa enabling them to achieve colonisation of a niche in the host, inhibit or evade the host's immune response, enter and exit cells, or obtain nutrition from the host. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| staphyloxanthin (CHEBI:71690) has functional parent 12-methyltetradecanoic acid (CHEBI:39251) |
| staphyloxanthin (CHEBI:71690) has functional parent β-D-glucose (CHEBI:15903) |
| staphyloxanthin (CHEBI:71690) has role antioxidant (CHEBI:22586) |
| staphyloxanthin (CHEBI:71690) has role biological pigment (CHEBI:26130) |
| staphyloxanthin (CHEBI:71690) has role metabolite (CHEBI:25212) |
| staphyloxanthin (CHEBI:71690) has role virulence factor (CHEBI:72316) |
| staphyloxanthin (CHEBI:71690) is a D-aldohexose derivative (CHEBI:63387) |
| staphyloxanthin (CHEBI:71690) is a apo carotenoid triterpenoid (CHEBI:36783) |
| staphyloxanthin (CHEBI:71690) is a fatty acid ester (CHEBI:35748) |
| staphyloxanthin (CHEBI:71690) is a triol (CHEBI:27136) |
| staphyloxanthin (CHEBI:71690) is a xanthophyll (CHEBI:27325) |
| IUPAC Name |
|---|
| 1-O-[(2E,4E,6E,8E,10E,12E,14E,16E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenoyl]-6-O-(12-methyltetradecanoyl)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 8'-apo-ψ,ψ-carotenoic acid, 6-O-(12-methyl-1-oxotetradecyl)-α-D-glucopyranosyl ester | ChemIDplus |
| β-D-glucopyranosyl 1-O-(4,4'-diaponeurosporen-4-oate)-6-O-(12-methyltetradecanoate) | MetaCyc |
| UniProt Name | Source |
|---|---|
| staphyloxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16148 | KEGG COMPOUND |
| CPD-9916 | MetaCyc |
| Staphyloxanthin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22781667 | Reaxys |
| CAS:71869-01-7 | ChemIDplus |
| CAS:71869-01-7 | KEGG COMPOUND |
| Citations |
|---|