EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H32O2 |
| Net Charge | 0 |
| Average Mass | 256.430 |
| Monoisotopic Mass | 256.24023 |
| SMILES | CCC(C)CCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C16H32O2/c1-4-15(2)13-11-9-7-5-6-8-10-12-14-16(17)18-3/h15H,4-14H2,1-3H3 |
| InChIKey | BJIUDNXPLSJWKE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carica papaya (ncbitaxon:3649) | leaf (BTO:0000713) | Article (Natural Products, an Indian Journal, 9(4), 143-147 (2013).) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 12-methyltetradecanoate (CHEBI:142658) has functional parent 12-methyltetradecanoic acid (CHEBI:39251) |
| methyl 12-methyltetradecanoate (CHEBI:142658) has role plant metabolite (CHEBI:76924) |
| methyl 12-methyltetradecanoate (CHEBI:142658) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl 12-methyltetradecanoate |
| Synonyms | Source |
|---|---|
| 12-methylmyristic acid methyl ester | ChEBI |
| 12-methyltetradecanoic acid methyl ester | ChEBI |
| methyl 12-methylmyristate | ChEBI |
| Citations |
|---|