EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H]C(CCC(=C)C=C)=C(C)CCC=C(C)C |
| InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3 |
| InChIKey | JSNRRGGBADWTMC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-farnesene (CHEBI:39241) is a farnesene (CHEBI:39237) |
| Incoming Relation(s) |
| cis-β-farnesene (CHEBI:39242) is a β-farnesene (CHEBI:39241) |
| trans-β-farnesene (CHEBI:10418) is a β-farnesene (CHEBI:39241) |
| Synonym | Source |
|---|---|
| 7,11-dimethyl-3-methylenedodeca-1,6,10-triene | ChEBI |
| UniProt Name | Source |
|---|---|
| β-farnesene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1750952 | Beilstein |